A4117912
1-Ethyl-3-methyl-1<I>H</I>-<WBR>pyrazole-<WBR>5-<WBR>carboxylic acid , 97% , 50920-65-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB36.00 | In Stock |
|
| 1G | RMB64.80 | In Stock |
|
| 5G | RMB460.00 | In Stock |
|
| 25g | RMB781.60 | In Stock |
|
| 100g | RMB2453.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 130 °C |
| Boiling point: | 308.5±22.0 °C(Predicted) |
| Density | 1.23±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.27±0.10(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C7H10N2O2/c1-3-9-6(7(10)11)4-5(2)8-9/h4H,3H2,1-2H3,(H,10,11) |
| InChIKey | VFMGOJUUTAPPDA-UHFFFAOYSA-N |
| SMILES | N1(CC)C(C(O)=O)=CC(C)=N1 |
| CAS DataBase Reference | 50920-65-5(CAS DataBase Reference) |
Description and Uses
1-Ethyl-3-methyl-1H-pyrazole-5-carboxylic Acid is a reagent used in the synthesis of new class of 2-phenylhydrazinylidene derivatives as antivirulence agents that inhibits staphylococcus aureus biofilm formation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| RTECS | UQ6407500 |
| HazardClass | IRRITANT |
| HS Code | 2933199090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |







