A4144531
N-Boc-4-methylene-L-proline , 95% , 84348-38-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB47.20 | In Stock |
|
| 1g | RMB79.20 | In Stock |
|
| 5g | RMB267.20 | In Stock |
|
| 25g | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110-115 °C |
| Boiling point: | 349.9±42.0 °C(Predicted) |
| Density | 1.18±0.1 g/cm3 (20 ºC 760 Torr) |
| storage temp. | 2-8°C(protect from light) |
| form | solid |
| pka | 3.80±0.20(Predicted) |
| Appearance | Off-white to light yellow Solid |
| optical activity | [α]22/D 58°, c = 0.5 in chloroform |
| Water Solubility | Insoluble in water. |
| Major Application | peptide synthesis |
| InChI | 1S/C11H17NO4/c1-7-5-8(9(13)14)12(6-7)10(15)16-11(2,3)4/h8H,1,5-6H2,2-4H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | ULLGRIBXGPATMA-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=C)C[C@H]1C(O)=O |
| CAS DataBase Reference | 84348-38-9 |
Description and Uses
As important intermediates in various areas such as peptide synthesis, asymmetric synthesis, medicinal chemistry, and polymer chemistry. The fluorous prolins were synthesized from commercially available N-Boc-4-methylene- L-proline.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





