A4187956
FluridoneSolutioninMethanol , 100 μg/mlinmethanol, uncertainty 3%
CAS NO.:
Empirical Formula: C19H14F3NO
Molecular Weight: 329.32
MDL number: MFCD00078682
EINECS: 261-916-6
| Pack Size | Price | Stock | Quantity |
| 1.2ml | RMB215.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154-155°C |
| Boiling point: | 444.4±45.0 °C(Predicted) |
| Density | 1.2686 (estimate) |
| storage temp. | 0-6°C |
| solubility | DMF: 30 mg/ml,DMSO: 30 mg/ml,DMSO:PBS (pH 7.2) (1:3): 0.25 mg/ml,Ethanol: 20 mg/ml |
| pka | 1.62±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| BRN | 1547990 |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C19H14F3NO/c1-23-11-16(13-6-3-2-4-7-13)18(24)17(12-23)14-8-5-9-15(10-14)19(20,21)22/h2-12H,1H3 |
| InChIKey | YWBVHLJPRPCRSD-UHFFFAOYSA-N |
| SMILES | C1N(C)C=C(C2=CC=CC(C(F)(F)F)=C2)C(=O)C=1C1=CC=CC=C1 |
| CAS DataBase Reference | 59756-60-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Fluridone(59756-60-4) |
| EPA Substance Registry System | Fluridone (59756-60-4) |
Description and Uses
Fluridone, is a new herbicide for aquatic plants, such as Curlyleaf pondweed (Potamogeton crispus) in lakes.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H311-H411 |
| Precautionary statements | P273-P280-P302+P352+P312-P361+P364-P391-P405 |
| PPE | Eyeshields, Faceshields, Gloves |
| Hazard Codes | N,Xn |
| Risk Statements | 51/53-21 |
| Safety Statements | 60-36/37 |
| RIDADR | UN 3077 |
| WGK Germany | 2 |
| RTECS | UU7786500 |
| TSCA | TSCA listed |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Aquatic Chronic 2 |
| Hazardous Substances Data | 59756-60-4(Hazardous Substances Data) |








