A4212356
6-(5-Chloro-2-pyridyl)-6,7-dihydro-7-hydroxy-5H-pyrrolo[3,4-b]pyrazin-5-one , 97% , 43200-81-3
CAS NO.:43200-81-3
Empirical Formula: C11H7ClN4O2
Molecular Weight: 262.65
MDL number: MFCD02684321
EINECS: 256-139-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB143.20 | In Stock |
|
| 1g | RMB358.40 | In Stock |
|
| 5g | RMB539.20 | In Stock |
|
| 25g | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 240.5-241.50C |
| Boiling point: | 525.2±50.0 °C(Predicted) |
| Density | 1.653±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 8.62±0.20(Predicted) |
| color | Off-White to Pale Beige |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C11H7ClN4O2/c12-6-1-2-7(15-5-6)16-10(17)8-9(11(16)18)14-4-3-13-8/h1-5,10,17H |
| InChIKey | FUUXOEKDNNWZTR-UHFFFAOYSA-N |
| SMILES | C12C(O)N(C3=NC=C(Cl)C=C3)C(=O)C1=NC=CN=2 |
| CAS DataBase Reference | 43200-81-3(CAS DataBase Reference) |
Description and Uses
Eszopiclone Impurity B.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P |

![6-(5-Chloro-2-pyridyl)-6,7-dihydro-7-hydroxy-5H-pyrrolo[3,4-b]pyrazin-5-one](https://img.chemicalbook.com/CAS/GIF/43200-81-3.gif)





