S7814748
UnitedStatesPharmacopeia(USP)ReferenceStandard , 43200-96-0
Synonym(s):
(5RS)-6-(5-Chloropyridin-2-yl)-7-oxo-6,7-dihydro-5H-pyrrolo[3,4-b]pyrazin-5-yl 4-methylpiperazine-1-carboxylate 4-oxide;Zopiclone oxide
CAS NO.:43200-96-0
Empirical Formula: C17H17ClN6O4
Molecular Weight: 404.81
MDL number: MFCD00871938
EINECS: 641-896-9
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB11317.23 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >140°C (dec.) |
| Flash point: | 9℃ |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly, Heated), DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) |
| form | liquid |
| pka | 4.92±0.20(Predicted) |
| color | White to Light Brown |
| Major Application | clinical testing |
| InChI | InChI=1S/C17H17ClN6O4/c1-24(27)8-6-22(7-9-24)17(26)28-16-14-13(19-4-5-20-14)15(25)23(16)12-3-2-11(18)10-21-12/h2-5,10,16H,6-9H2,1H3 |
| InChIKey | IPTIKKTXLHVRKN-UHFFFAOYSA-N |
| SMILES | N1(C(OC2C3=NC=CN=C3C(=O)N2C2=NC=C(Cl)C=C2)=O)CC[N+]([O-])(C)CC1 |
Description and Uses
A metabolite of Zopiclone
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P233-P280-P301+P310-P303+P361+P353-P304+P340+P311 |
| target organs | Eyes,Central nervous system |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol |
| WGK Germany | 1 |
| HS Code | 2933790002 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |





![6-(5-Chloro-2-pyridyl)-6,7-dihydro-7-hydroxy-5H-pyrrolo[3,4-b]pyrazin-5-one](https://img.chemicalbook.com/CAS/GIF/43200-81-3.gif)



![6-(5-Chloro-2-Pyridyl)-5H-Pyrrolo[3,4-b]Pyrazine-5,7(6H)-Dione](https://img.chemicalbook.com/CAS/GIF/43200-82-4.gif)