A4215612
ETHYL 2-PENTYNOATE , 98% , 55314-57-3
CAS NO.：55314-57-3
Empirical Formula: C7H10O2
Molecular Weight: 126.15
MDL number: MFCD00015221
EINECS: 259-588-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB132.00 | In Stock |
|
| 5G | RMB434.40 | In Stock |
|
| 25G | RMB1582.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 178-179 °C (lit.) |
| Density | 0.957 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 102 °F |
| storage temp. | 2-8°C |
| Specific Gravity | 0.957 |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | Not miscible in water. |
| BRN | 1750016 |
| InChI | InChI=1S/C7H10O2/c1-3-5-6-7(8)9-4-2/h3-4H2,1-2H3 |
| InChIKey | XDPRPKSTFBPPHU-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C#CCC |
Description and Uses
Ethyl 2-pentynoate is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) |    GHS02,GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H226-H318-H334 |
| Precautionary statements | P261-P280-P305+P351+P338-P342+P311 |
| Hazard Codes | Xi |
| Risk Statements | 10-43 |
| Safety Statements | 16-37/39 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29161900 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
