BD3931846
Pent-2-ynoicacid , 95% , 5963-77-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB64.80 | In Stock |
|
| 1g | RMB200.00 | In Stock |
|
| 5g | RMB814.40 | In Stock |
|
| 10g | RMB1541.60 | In Stock |
|
| 25g | RMB2960.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 47-53 °C |
| Boiling point: | 125°C 30mm |
| Density | 1.1133 (rough estimate) |
| refractive index | 1.4619 |
| Flash point: | 96 °C |
| storage temp. | 2-8°C |
| form | Solid |
| pka | 2.70±0.10(Predicted) |
| Appearance | White to yellow Solid |
| InChI | InChI=1S/C5H6O2/c1-2-3-4-5(6)7/h2H2,1H3,(H,6,7) |
| InChIKey | MINRDQDGBLQBGD-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C#CCC |
Description and Uses
2-Pentynoic Acid is a chemical reagent used in the preparation of various organic molecule. Used in the stereoselective synthesis of vinylstannanes. In addition, it is used in the synthesis of spiroindolines derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 34-36/37/38-22 |
| Safety Statements | 26-36/37/39-36 |
| RIDADR | 3261 |
| WGK Germany | 1 |
| HS Code | 29161900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






