A4215912
0 , 98% , 74288-40-7
Synonym(s):
B-CK;CKB;CKBB;Creatine kinase B-type
CAS NO.：74288-40-7
Empirical Formula: C16H16N2O7
Molecular Weight: 348.31
MDL number: MFCD08458409
EINECS: 616-072-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB319.20 | In Stock |
|
| 100G | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 108-110°C |
| Boiling point: | 601.3±55.0 °C(Predicted) |
| Density | 1.50±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 11.26±0.40(Predicted) |
| color | White to Pale Beige |
| biological source | rabbit |
| InChI | InChI=1S/C16H16N2O7/c1-8(19)13-11-6-12(20)14(17(11)15(13)21)16(22)25-7-9-2-4-10(5-3-9)18(23)24/h2-5,8,11,13-14,19H,6-7H2,1H3/t8-,11-,13-,14?/m1/s1 |
| InChIKey | YBIDYTOJOXKBLO-USLOAXSXSA-N |
| SMILES | N12[C@@]([H])([C@@H]([C@H](O)C)C1=O)CC(=O)C2C(OCC1=CC=C([N+]([O-])=O)C=C1)=O |
| CAS DataBase Reference | 74288-40-7(CAS DataBase Reference) |
Description and Uses
Imipenem intermediate.
