A7139512
Imipenem monohydrate , ≥95%(HPLC) , 74431-23-5
Synonym(s):
(5R,6S)-6-[(1R)-1-Hydroxyethyl]-3-[[2-[(iminomethyl)amino]ethyl]thio]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid monohydrate;Imipenem monohydrate;Primaxin monohydrate;Tienam monohydrate
CAS NO.:74431-23-5
Empirical Formula: C12H19N3O5S
Molecular Weight: 317.36
MDL number: MFCD00864955
EINECS: 680-398-6
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB180.00 | In Stock |
|
| 250MG | RMB537.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 193-198°C |
| Boiling point: | 567℃ |
| RTECS | CL5446516 |
| Flash point: | >110°(230°F) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | H2O: >5mg/mL |
| pka | pKa 3.2/9.9(H2O,t = 25) (Uncertain) |
| form | powder |
| color | white to beige |
| optical activity | [α]/D +73 to +84°, c =0.5 in water |
| Water Solubility | Soluble in water at 5mg/ml |
| InChI | InChI=1/C12H17N3O4S.H2O/c1-6(16)9-7-4-8(20-3-2-14-5-13)10(12(18)19)15(7)11(9)17;/h5-7,9,16H,2-4H2,1H3,(H2,13,14)(H,18,19);1H2/t6-,7-,9-;/s3 |
| InChIKey | GSOSVVULSKVSLQ-ONZDYIGBNA-N |
| SMILES | C(C1=C(C[C@]2([H])[C@@]([H])([C@H](O)C)C(=O)N12)SCCNC=N)(=O)O.O |&1:4,6,8,r| |
| CAS DataBase Reference | 74431-23-5(CAS DataBase Reference) |
Description and Uses
antidiabetic
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| WGK Germany | 3 |
| HS Code | 2941906000 |





![(3<i>S</i>,4<i>S</i>)-3-[(<i>R</i>)-1-(<i>tert</i>-Butyldimethylsilyloxy)ethyl]-4-[(<i>R</i>)-1-carboxyethyl]-2-azetidinone](https://img.chemicalbook.com/CAS/GIF/90776-58-2.gif)
