A4273220
4-Chloro-3-hydroxybenzoic acid , 98% , 34113-69-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1G | RMB41.60 | In Stock |
|
| 5G | RMB150.40 | In Stock |
|
| 10g | RMB287.20 | In Stock |
|
| 25G | RMB639.20 | In Stock |
|
| 100g | RMB2383.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 219.5-220.5 °C |
| Boiling point: | 345.4±27.0 °C(Predicted) |
| Density | 1.536±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO, Methanol |
| form | Solid |
| pka | 3.85±0.10(Predicted) |
| color | Light Beige |
| InChI | InChI=1S/C7H5ClO3/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,9H,(H,10,11) |
| InChIKey | SCPUNJAMWFAYED-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Cl)C(O)=C1 |
| CAS DataBase Reference | 34113-69-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 4-chloro-3-hydroxy-(34113-69-4) |
Description and Uses
4-Chloro-3-hydroxy-Benzoic Acid acts as a potential inhibitor of influenza endonuclease used in the treatment of influenza. Also used in the synthesis of highly selective Tie-2 kinase inhibitors used in the treatment of tumors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Hazard Note | Irritant |
| HS Code | 2918199890 |
