A4275112
D(+)-Fucose , 98% , 3615-37-0
Synonym(s):
6-Deoxy-D -galactose;Rhodeose
CAS NO.:3615-37-0
Empirical Formula: C6H12O5
Molecular Weight: 164.16
MDL number: MFCD00135603
EINECS: 222-792-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB431.20 | In Stock |
|
| 5G | RMB1918.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 144-145 °C(lit.) |
| alpha | D19 +127.0° (7 min) +89.4° (31 min) +77.2° (71 min) +76.0° (final value 146 min, c = 10) |
| Boiling point: | 211.61°C (rough estimate) |
| Density | 1.1738 (rough estimate) |
| refractive index | 75.5 ° (C=10, H2O) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| pka | 12.50±0.20(Predicted) |
| form | Crystalline Powder |
| color | White |
| optical activity | +153 → +76 |
| Sensitive | Hygroscopic |
| Merck | 14,4278 |
| BRN | 1723320 |
| InChI | 1S/C6H12O5/c1-3(8)5(10)6(11)4(9)2-7/h2-6,8-11H,1H3/t3-,4+,5+,6-/m1/s1 |
| InChIKey | PNNNRSAQSRJVSB-DPYQTVNSSA-N |
| SMILES | C[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C=O |
| LogP | -2.040 (est) |
| CAS DataBase Reference | 3615-37-0(CAS DataBase Reference) |
| EPA Substance Registry System | D-Galactose, 6-deoxy- (3615-37-0) |
Description and Uses
D-Fucose is a hexose deoxy sugar found on N-linked glycans that appears on the cell surface of mammalian and plant cells. D-Fucose is also the building block of fucoidan polysaccharide, an sulfated polysaccharide found in various species of brown algae.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36/37/39-27-26 |
| WGK Germany | 3 |
| F | 3-10 |
| TSCA | TSCA listed |
| HS Code | 29400000 |
| Storage Class | 11 - Combustible Solids |




![1-D-a-Galactopyranosyl-4-O-[1-(2-octadecylthioethyl)-(b-D-galactopyranoside)]](https://img.chemicalbook.com/StructureFile/ChemBookStructure1/GIF/CB2225780.gif)
