A4275212
Fmoc-Cys(Trt)-OH , 98% , 103213-32-7
Synonym(s):
N-(9-Fluorenylmethoxycarbonyl)-S-trityl-L -cysteine;Nα-Fmoc-S-trityl-L -cysteine;Fmoc-Cys(Trt)-OH;N-α-Fmoc-S-trityl-L-cysteine
CAS NO.:103213-32-7
Empirical Formula: C37H31NO4S
Molecular Weight: 585.71
MDL number: MFCD00038538
EINECS: 600-408-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB103.20 | In Stock |
|
| 100G | RMB356.00 | In Stock |
|
| 500g | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170-173 °C(lit.) |
| alpha | 16 º (c=1, THF) |
| Boiling point: | 763.4±60.0 °C(Predicted) |
| Density | 1.270±0.06 g/cm3(Predicted) |
| refractive index | 18 ° (C=1, THF) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | 3.70±0.10(Predicted) |
| form | Powder |
| color | White to almost white |
| optical activity | [α]20/D +16.0±2°, c = 1% in THF |
| Water Solubility | Insoluble in water. Soluble in most organic solvents. |
| BRN | 4221286 |
| Major Application | peptide synthesis |
| InChIKey | KLBPUVPNPAJWHZ-UMSFTDKQSA-N |
| SMILES | OC(=O)[C@H](CSC(c1ccccc1)(c2ccccc2)c3ccccc3)NC(=O)OCC4c5ccccc5-c6ccccc46 |
| CAS DataBase Reference | 103213-32-7(CAS DataBase Reference) |
Description and Uses
Fmoc-Cys(Trt)-OH is an N-terminal protected cysteine derivative used in peptide synthesis. Some of the examples are:
- Synthesis of mono- and bi-functionalized platinum(IV) complexes to target angiogenic tumor vasculature.
- Synthesis of proteins through native chemical ligation of peptide hydrazides as thioester surrogates via solid-phase synthesis.
- Synthesis of glycoconjugates by conjugating reducing sugars to cysteine residues of peptides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-26 |
| WGK Germany | 3 |
| F | 9-21 |
| Hazard Note | Irritant |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |







