A4300212
Fmoc-Gln(Trt)-OH , 95% , 132327-80-1
Synonym(s):
Nα-Fmoc-Nδ-trityl-L -glutamine;Fmoc-Gln(Trt)-OH;N-α-Fmoc-N-γ-trityl-L-glutamine
CAS NO.:132327-80-1
Empirical Formula: C39H34N2O5
Molecular Weight: 610.7
MDL number: MFCD00077056
EINECS: 603-564-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB44.00 | In Stock |
|
| 25G | RMB158.40 | In Stock |
|
| 100G | RMB612.80 | In Stock |
|
| 500g | RMB3040.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-172 °C |
| Boiling point: | 873.5±65.0 °C(Predicted) |
| Density | 1.256±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | 3.73±0.10(Predicted) |
| form | Powder |
| color | White to yellow |
| optical activity | [α]/D -14.0±1.5°, c = 1% in DMF |
| Sensitive | Moisture Sensitive |
| BRN | 4343953 |
| Major Application | peptide synthesis |
| InChIKey | WDGICUODAOGOMO-DHUJRADRSA-N |
| SMILES | C(O)(=O)[C@H](CCC(N)=O)N(C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)C(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS DataBase Reference | 132327-80-1(CAS DataBase Reference) |
Description and Uses
FMOC-GLN(TRT)-OH, is an amino acid derivative used in chemical synthesis and peptide chemistry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H413 |
| Precautionary statements | P261-P280g-P302+P352a-P321-P333+P313-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-53-43 |
| Safety Statements | 22-24/25-26-61-37-24 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 2924 29 70 |
| Storage Class | 11 - Combustible Solids |







