A4277512
2'-Fluoroacetophenone , 98% , 445-27-2
CAS NO.:445-27-2
Empirical Formula: C8H7FO
Molecular Weight: 138.14
MDL number: MFCD00000320
EINECS: 207-156-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB47.20 | In Stock |
|
| 100G | RMB135.20 | In Stock |
|
| 500G | RMB607.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 26-27C |
| Boiling point: | 187-189 °C(lit.) |
| Density | 1.137 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | 143 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in Acetone, Chloroform, Dichloromethane, Ethanol, Ethyl Acetate and Methanol. |
| form | Liquid |
| Specific Gravity | 1.121 |
| color | Clear colorless to yellow |
| BRN | 2041344 |
| InChI | InChI=1S/C8H7FO/c1-6(10)7-4-2-3-5-8(7)9/h2-5H,1H3 |
| InChIKey | QMATYTFXDIWACW-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=CC=C1F)C |
| CAS DataBase Reference | 445-27-2(CAS DataBase Reference) |
| NIST Chemistry Reference | o-Fluoroacetophenone(445-27-2) |
Description and Uses
2'-Fluoroacetophenone is used as starting reagent in the synthesis of ascididemin. It is used to produce 1-(2-piperidin-1-yl-phenyl)-ethanone by reaction with piperidine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39-37 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29147090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







