A1360912
2′-Bromoacetophenone , >98.0%(GC) , 2142-69-0
Synonym(s):
1-Acetyl-2-bromobenzene
CAS NO.:2142-69-0
Empirical Formula: C8H7BrO
Molecular Weight: 199.04
MDL number: MFCD00000067
EINECS: 218-398-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB40.00 | In Stock |
|
| 25G | RMB140.80 | In Stock |
|
| 50g | RMB271.20 | In Stock |
|
| 100G | RMB525.60 | In Stock |
|
| 250g | RMB1303.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | °C |
| Boiling point: | 116-117 °C (12 mmHg) |
| Density | 1.476 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| Specific Gravity | 1.476 |
| color | Clear pale yellow to orange |
| Water Solubility | PRACTICALLY INSOLUBLE |
| BRN | 1931534 |
| InChI | InChI=1S/C8H7BrO/c1-6(10)7-4-2-3-5-8(7)9/h2-5H,1H3 |
| InChIKey | PIMNFNXBTGPCIL-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=CC=C1Br)C |
| CAS DataBase Reference | 2142-69-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethanone, 1-(2-bromophenyl)-(2142-69-0) |
Description and Uses
2-bromoacetophenone is employed in the selective derivatization of cytosine moieties for the determination of global DNA methylation by reversed phase high performance liquid chromatography with spectrofluorimetric detection.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P280g-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38-34 |
| Safety Statements | 26-36-37/39-45-36/37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29147090 |







