A4277912
Fmoc-propargyl-Gly-OH , 98% , 198561-07-8
Synonym(s):
(S)-2-(Fmoc-amino)-4-pentynoic acid;Fmoc-L -2-propargylglycine
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB140.80 | In Stock |
|
| 1G | RMB266.40 | In Stock |
|
| 5G | RMB714.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175 °C |
| Boiling point: | 472°C (rough estimate) |
| Density | 1.2712 (rough estimate) |
| refractive index | 1.5600 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Sparingly) |
| form | Solid |
| pka | 3.42±0.10(Predicted) |
| color | White to Off-White |
| optical activity | 8.4416°(C=1.0081g/100ml MEOH) |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C20H17NO4/c1-2-7-18(19(22)23)21-20(24)25-12-17-15-10-5-3-8-13(15)14-9-4-6-11-16(14)17/h1,3-6,8-11,17-18H,7,12H2,(H,21,24)(H,22,23)/t18-/m0/s1 |
| InChIKey | DJGMNCKHNMRKFM-SFHVURJKSA-N |
| SMILES | C(O)(=O)[C@@H](NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)CC#C |
| CAS DataBase Reference | 198561-07-8(CAS DataBase Reference) |
Description and Uses
Fmoc-propargyl-Gly-OH is an Fmoc protected glycine derivative useful for solid phase peptide synthesis techniques. This compound could be useful as an unusual amino acid analog to aid in the deconvolution of protein structure and function. N-Fmoc-L-propargylglycine is a non-natural amino acids used for the triazole cross-link.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P261 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 24/25-25-24 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |







