BD5159741
(S)-3-((tert-Butoxycarbonyl)amino)hex-5-enoicacid , 98% , 270263-03-1
Synonym(s):
Boc-(S)-3-amino-5-hexenoic acid
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB372.00 | In Stock |
|
| 250mg | RMB556.00 | In Stock |
|
| 1g | RMB1384.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 372.2±35.0 °C(Predicted) |
| Density | 1.078 |
| storage temp. | 2-8°C |
| form | lumps |
| pka | 4.43±0.10(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | [α]/D +20±1°, c = 1 in ethanol |
| BRN | 9127734 |
| Major Application | peptide synthesis |
| InChI | 1S/C11H19NO4/c1-5-6-8(7-9(13)14)12-10(15)16-11(2,3)4/h5,8H,1,6-7H2,2-4H3,(H,12,15)(H,13,14)/t8-/m0/s1 |
| InChIKey | RFHPQLCVYMBPRF-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC=C)CC(O)=O |
Description and Uses
(S)-3-(Boc-amino)-5-hexenoic acid can be used as a reactant for the preparation of lactam bridged peptide mimics by peptide coupling and olefin metathesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29241990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
