A4278012
Fmoc-D-propargyl-Gly-OH , 96% , 220497-98-3
Synonym(s):
(R)-2-(Fmoc-amino)-4-pentynoic acid;Fmoc-D -2-propargylglycine
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB60.80 | In Stock |
|
| 1G | RMB155.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155 °C |
| Boiling point: | 472°C (rough estimate) |
| Density | 1.2712 (rough estimate) |
| refractive index | 1.5600 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMF (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 3.42±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| optical activity | Consistent with structure |
| InChI | InChI=1S/C20H17NO4/c1-2-7-18(19(22)23)21-20(24)25-12-17-15-10-5-3-8-13(15)14-9-4-6-11-16(14)17/h1,3-6,8-11,17-18H,7,12H2,(H,21,24)(H,22,23)/t18-/m1/s1 |
| InChIKey | DJGMNCKHNMRKFM-GOSISDBHSA-N |
| SMILES | C(O)(=O)[C@H](NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)CC#C |
| CAS DataBase Reference | 220497-98-3(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| Hazard Codes | Xi |
| Safety Statements | 24/25-25-24 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
