A4279112
Fmoc-Phe(4-Br)-OH , 98% , 198561-04-5
Synonym(s):
Fmoc-4-bromo-L -phenylalanine
CAS NO.：198561-04-5
Empirical Formula: C24H20BrNO4
Molecular Weight: 466.32
MDL number: MFCD00273460
| Pack Size | Price | Stock | Quantity |
| 1G | RMB121.60 | In Stock |
|
| 10g | RMB712.80 | In Stock |
|
| 25g | RMB1264.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 151.5 °C |
| Boiling point: | 660.8±55.0 °C(Predicted) |
| Density | 1.4220 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 3.72±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| InChIKey | TVBAVBWXRDHONF-QFIPXVFZSA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=C(Br)C=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 198561-04-5(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H413 |
| Precautionary statements | P261-P273-P305+P351+P338 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
