BD7958131
Fmoc-Bpa-OH , 95% , 117666-96-3
Synonym(s):
(S)-3-(4-Benzoyl-phenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-propionic acid,4-Benzoyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]phenylalanine;Fmoc-4-benzoyl-L -phenylalanine;Fmoc-p-Bz-Phe-OH
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB159.20 | In Stock |
|
| 1g | RMB400.00 | In Stock |
|
| 5g | RMB1435.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 729.0±60.0 °C(Predicted) |
| Density | 1.288±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | Powder |
| pka | 3.68±0.10(Predicted) |
| color | White |
| optical activity | -27.4°(C=0.01 g/mL, DMF, 20°C, 589nm) |
| BRN | 7672022 |
| Major Application | peptide synthesis |
| InChIKey | SYOBJKCXNRQOGA-NDEPHWFRSA-N |
| SMILES | OC(=O)[C@H](Cc1ccc(cc1)C(=O)c2ccccc2)NC(=O)OCC3c4ccccc4-c5ccccc35 |
| CAS DataBase Reference | 117666-96-3(CAS DataBase Reference) |
Description and Uses
Fmoc-bpa-oh is a reagent used in the identification of potent muscarinic acetylcholine receptor antagonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |







