A4280912
4-Fluorobenzoic Acid Ethyl Ester , 99% , 451-46-7
CAS NO.：451-46-7
Empirical Formula: C9H9FO2
Molecular Weight: 168.16
MDL number: MFCD00000351
EINECS: 207-194-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB38.40 | In Stock |
|
| 100G | RMB83.20 | In Stock |
|
| 500G | RMB311.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 25-27°C |
| Boiling point: | 210 °C (lit.) |
| Density | 1.146 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 178 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Low Melting Solid |
| color | Colorless to pale yellow |
| Specific Gravity | 1.146 |
| Merck | 14,4171 |
| BRN | 1866794 |
| InChI | InChI=1S/C9H9FO2/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6H,2H2,1H3 |
| InChIKey | UMPRJGKLMUDRHL-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C1=CC=C(F)C=C1 |
| CAS DataBase Reference | 451-46-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 4-fluoro-, ethyl ester(451-46-7) |
| EPA Substance Registry System | Benzoic acid, 4-fluoro-, ethyl ester (451-46-7) |
Description and Uses
Ethyl 4-fluorobenzoate may be used in the synthesis of 4,4′-(1,4-piperazinediyl) bisbenzoic acid ethyl ester.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | F,Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 23-24/25-25-24 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29163900 |
