A4294312
4-Fluorobenzoic Acid Methyl Ester , 97% , 403-33-8
CAS NO.：403-33-8
Empirical Formula: C8H7FO2
Molecular Weight: 154.14
MDL number: MFCD00017959
EINECS: 206-956-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB46.40 | In Stock |
|
| 100G | RMB110.40 | In Stock |
|
| 500G | RMB391.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 4.5 °C |
| Boiling point: | 90-92 °C/20 mmHg (lit.) |
| Density | 1.192 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 172 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| Specific Gravity | 1.201.192 |
| color | Clear Colourless |
| BRN | 2085925 |
| InChI | InChI=1S/C8H7FO2/c1-11-8(10)6-2-4-7(9)5-3-6/h2-5H,1H3 |
| InChIKey | MSEBQGULDWDIRW-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(F)C=C1 |
| CAS DataBase Reference | 403-33-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-F-C6H4-COOCH3(403-33-8) |
Description and Uses
Methyl 4-fluorobenzoate can be used in the synthesis of trisubstituted imidazole derivatives containing a 4-fluorophenyl group, a pyrimidine ring, and a CN- or CONH2-substituted benzyl moiety.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 22-37/38-41-36/38 |
| Safety Statements | 26-36/39-36 |
| RIDADR | NA1993 |
| WGK Germany | 2 |
| Hazard Note | Toxic |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Excepted Quantities | Non-Hazardous |
