A4281212
4-Fluoro-2-methylphenylboronic acid , 97% , 139911-29-8
Synonym(s):
2-Methyl-4-fluorophenylboronic acid
CAS NO.：139911-29-8
Empirical Formula: C7H8BFO2
Molecular Weight: 153.95
MDL number: MFCD02093072
EINECS: 642-527-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB59.20 | In Stock |
|
| 25G | RMB221.60 | In Stock |
|
| 100g | RMB759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 191-196 °C(lit.) |
| Boiling point: | 277.4±50.0 °C(Predicted) |
| Density | 1.20±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly, Sonicated), DMSO (Slightly), Methanol (Slightly) |
| pka | 8.75±0.58(Predicted) |
| form | Powder |
| color | White to off-white |
| InChI | InChI=1S/C7H8BFO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4,10-11H,1H3 |
| InChIKey | IQMLIVUHMSIOQP-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(F)C=C1C)(O)O |
| CAS DataBase Reference | 139911-29-8(CAS DataBase Reference) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36/37/39-27 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
