A4285420
Ethyl (4-methylbenzoyl)acetate , 95% , 27835-00-3
Synonym(s):
Ethyl 3-(4-methylphenyl)-3-oxopropanoate;Ethyl 3-oxo-3-(4-tolyl)propionate;NSC 158544
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB60.00 | In Stock |
|
| 1G | RMB152.80 | In Stock |
|
| 5G | RMB627.20 | In Stock |
|
| 10g | RMB1066.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93 °C(Solv: chloroform (67-66-3); ligroine (8032-32-4)) |
| Boiling point: | 244-245 °C(lit.) |
| Density | 1.056 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 10.12±0.25(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| InChI | 1S/C12H14O3/c1-3-15-12(14)8-11(13)10-6-4-9(2)5-7-10/h4-7H,3,8H2,1-2H3 |
| InChIKey | GEQMJBPKCOZHMV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1ccc(C)cc1 |
| CAS DataBase Reference | 27835-00-3(CAS DataBase Reference) |
Description and Uses
Ethyl (4-methylbenzoyl)acetate may be used to synthesize 2-(carboethoxy)-3-(4′-methyl)phenylquinoxaline 1,4-dioxide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |







