BD8023631
Ethyl 3-oxo-3-(4-(trifluoromethyl)phenyl)propanoate , 98% , 106263-53-0
Synonym(s):
3-Oxo-3-(4-trifluoromethylphenyl)propanoic acid ethyl ester;Ethyl 2-4-(Trifluoromethyl)benzoylacetate;Ethyl 3-(4-trifluoromethylphenyl)-3-oxopropionate;Ethyl 3-oxo-3-4-(trifluoromethyl)phenylpropanoate
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB43.20 | In Stock |
|
| 1g | RMB100.80 | In Stock |
|
| 5g | RMB383.20 | In Stock |
|
| 10g | RMB744.80 | In Stock |
|
| 25g | RMB1597.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 248-249 °C(lit.) |
| Density | 1.270 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 9.09±0.25(Predicted) |
| form | liquid |
| color | Light yellow |
| InChI | 1S/C12H11F3O3/c1-2-18-11(17)7-10(16)8-3-5-9(6-4-8)12(13,14)15/h3-6H,2,7H2,1H3 |
| InChIKey | HVHVSJPSNQIPEM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1ccc(cc1)C(F)(F)F |
| CAS DataBase Reference | 106263-53-0(CAS DataBase Reference) |
Description and Uses
Reactant for:
- In-catalyzed cycloisomerization
- Chiral Lewis base-catalyzed stereoselective reduction with trichlorosilane and water
- Guanidine-catalyzed enantioselective Michael reactions
- Transesterification reactions
- Intermolecular coupling reactions
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | F |
| WGK Germany | 3 |
| HS Code | 2918300090 |
| Storage Class | 10 - Combustible liquids |






