A4286812
2-Fluoro-3-methoxyphenylboronic acid , 97% , 352303-67-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB67.20 | In Stock |
|
| 25G | RMB236.80 | In Stock |
|
| 100g | RMB783.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 117-122 °C (lit.) |
| Boiling point: | 326.8±52.0 °C(Predicted) |
| Density | 1.26±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly, Heated), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 7.90±0.58(Predicted) |
| color | Off-White to Pale Beige |
| BRN | 9191510 |
| InChI | InChI=1S/C7H8BFO3/c1-12-6-4-2-3-5(7(6)9)8(10)11/h2-4,10-11H,1H3 |
| InChIKey | JCKZNMSBFBPDPM-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC(OC)=C1F)(O)O |
| LogP | 1.14 |
| CAS DataBase Reference | 352303-67-4(CAS DataBase Reference) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | IRRITANT |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 |
| REACH Registrations | Active |






