A4289312
Fmoc-D-Phe-OH , 98% , 86123-10-6
Synonym(s):
Fmoc-D -phenylalanine;Fmoc-D-Phe-OH;N-α-Fmoc-D-phenylalanine
CAS NO.:86123-10-6
Empirical Formula: C24H21NO4
Molecular Weight: 387.43
MDL number: MFCD00062955
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB27.20 | In Stock |
|
| 25G | RMB93.60 | In Stock |
|
| 100G | RMB299.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 181-185°C |
| Boiling point: | 620.1±50.0 °C(Predicted) |
| Density | 1.276±0.06 g/cm3(Predicted) |
| refractive index | 38 ° (C=1, DMF) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | 3.77±0.10(Predicted) |
| form | Powder or Crystalline Powder |
| color | White |
| optical activity | 39°(C=0.01 g/mI, DMF, 20°C, 589nm) |
| BRN | 4767931 |
| InChI | InChI=1S/C24H21NO4/c26-23(27)22(14-16-8-2-1-3-9-16)25-24(28)29-15-21-19-12-6-4-10-17(19)18-11-5-7-13-20(18)21/h1-13,21-22H,14-15H2,(H,25,28)(H,26,27)/t22-/m1/s1 |
| InChIKey | SJVFAHZPLIXNDH-JOCHJYFZSA-N |
| SMILES | C(O)(=O)[C@@H](CC1=CC=CC=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 86123-10-6(CAS DataBase Reference) |
Description and Uses
N-Fmoc-D-phenylalanine is an N-Fmoc-protected form of D-Phenylalanine (P319410). D-Phenylalanine is an essential amino acid that serves as a primary precursor for the biosynthesis of catecholamines in the body. D-Phenylalanine is also known to antagonize stress-induced analgesia in humans, and also acts as an anti-enkephalinase agent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29242990 |







