A4325612
Fmoc-D-Trp(Boc)-OH , 97% , 163619-04-3
Synonym(s):
Nα-Fmoc-N(in)-Boc-D -tryptophan;Fmoc-D-Trp(Boc)-OH;N-α-Fmoc-N-in-t.-Boc-D-tryptophan
| Pack Size | Price | Stock | Quantity |
| 1G | RMB75.20 | In Stock |
|
| 5G | RMB267.20 | In Stock |
|
| 25G | RMB1048.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.28±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.71±0.10(Predicted) |
| color | White to off-white |
| optical activity | Consistent with structure |
| BRN | 7062970 |
| Major Application | peptide synthesis |
| InChIKey | ADOHASQZJSJZBT-AREMUKBSSA-N |
| SMILES | C(O)(=O)[C@@H](CC1C2=C(C=CC=C2)N(C(OC(C)(C)C)=O)C=1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 163619-04-3(CAS DataBase Reference) |
Description and Uses
Fmoc-D-Trp(Boc)-OH, is an amino acid derivative used in peptide chemistry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P261 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |






