A4275412
Fmoc-D-Lys(Boc)-OH , 99% , 92122-45-7
Synonym(s):
Nα-Fmoc-N-ε-Boc-D -lysine;Fmoc-D-Lys(Boc)-OH;N-α-Fmoc-N-ε-t.-Boc-D-lysine
CAS NO.:92122-45-7
Empirical Formula: C26H32N2O6
Molecular Weight: 468.54
MDL number: MFCD00270743
EINECS: 804-633-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.00 | In Stock |
|
| 5G | RMB103.20 | In Stock |
|
| 100g | RMB1626.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 135-139°C |
| Boiling point: | 685.7±55.0 °C(Predicted) |
| Density | 1.210±0.06 g/cm3(Predicted) |
| refractive index | 2.2 ° (C=1, MeOH) |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), DMF (Sparingly) |
| pka | 3.88±0.21(Predicted) |
| form | Solid |
| color | White to Off-White |
| Major Application | peptide synthesis |
| InChIKey | UMRUUWFGLGNQLI-JOCHJYFZSA-N |
| SMILES | C(O)(=O)[C@@H](CCCCNC(OC(C)(C)C)=O)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 92122-45-7(CAS DataBase Reference) |
Description and Uses
Derivative of N6-?[(1,?1-?Dimethylethoxy)?carbonyl]?-?N2-?[(9H-?fluoren-?9-?ylmethoxy)?carbonyl]?-D-?lysine is a hetero-bifunctional traceless linker for temporarily attaching highly solubilizing peptide sequences onto insoluble peptides.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61-24/25 |
| WGK Germany | 3 |
| HS Code | 29225090 |
| Storage Class | 11 - Combustible Solids |






