A4318412
Fmoc-D-Thr(tBu)-OH , 98% , 138797-71-4
Synonym(s):
Fmoc-O-tert-butyl-D -threonine;Fmoc-D-Thr(tBu)-OH;N-α-Fmoc-O-t.-butyl-D-threonine / (2R,3S)
| Pack Size | Price | Stock | Quantity |
| 1G | RMB37.60 | In Stock |
|
| 5G | RMB131.20 | In Stock |
|
| 25g | RMB640.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~130 °C |
| Boiling point: | 581.7±50.0 °C(Predicted) |
| Density | 1?+-.0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| pka | 3.42±0.10(Predicted) |
| form | Powder |
| color | Pale yellow |
| optical activity | [α]20/D 15±1.5°, c = 1% in ethyl acetate |
| BRN | 8796152 |
| InChIKey | LZOLWEQBVPVDPR-VBKZILBWSA-N |
| SMILES | C(O)(=O)[C@@H]([C@@H](OC(C)(C)C)C)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 138797-71-4(CAS DataBase Reference) |
Description and Uses
O-(1,1-Dimethylethyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-threonine is a reagent used in developing CNS active opioid glycopeptides which are potential drug candidates that penetrate the blood-brain barrier to produce potent central effects.
