A4292212
3-Fluorobenzoic acid , 98% , 455-38-9
CAS NO.:455-38-9
Empirical Formula: C7H5FO2
Molecular Weight: 140.11
MDL number: MFCD00002489
EINECS: 207-248-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25G | RMB28.80 | In Stock |
|
| 100G | RMB100.00 | In Stock |
|
| 250G | RMB158.40 | In Stock |
|
| 500G | RMB302.40 | In Stock |
|
| 2.5kg | RMB1413.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 122-124 °C (lit.) |
| Boiling point: | 226.1°C (rough estimate) |
| Density | 1.474 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 1.5g/l |
| form | Powder |
| pka | 3.86(at 25℃) |
| color | White to light yellow |
| Water Solubility | Very soluble in water. |
| BRN | 1906920 |
| InChI | InChI=1S/C7H5FO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H,9,10) |
| InChIKey | MXNBDFWNYRNIBH-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(F)=C1 |
| CAS DataBase Reference | 455-38-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 3-fluoro-(455-38-9) |
| EPA Substance Registry System | Benzoic acid, 3-fluoro- (455-38-9) |
Description and Uses
3-Fluorobenzoic Acid (cas# 455-38-9) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 37/38-36/37/38 |
| Safety Statements | 22-28-24/25-37/39-26-36 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






