A4297420
Phenolphthalein indicator , 0.1% , 77-09-8
Synonym(s):
3,3-Bis(4-hydroxyphenyl)-1(3H)-isobenzofuranone
CAS NO.:77-09-8
Empirical Formula: C20H14O4
Molecular Weight: 318.32
MDL number: MFCD00005913
EINECS: 201-004-7
| Pack Size | Price | Stock | Quantity |
| 100ml | RMB47.20 | In Stock |
|
| 500ml | RMB183.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 261-263 °C (lit.) |
| Boiling point: | 417.49°C (rough estimate) |
| Density | 1.27 g/cm3 at 32 °C |
| bulk density | 350-450kg/m3 |
| vapor pressure | <0.00001 Pa ( 50 °C) |
| refractive index | 1.5400 (estimate) |
| Flash point: | 24 °C |
| storage temp. | no restrictions. |
| solubility | Soluble in alcohol. Slightly soluble in ether. Slightly soluble in dimethyl sulfoxide and insoluble in benzene or hexane. |
| form | Solid |
| pka | 9.4(at 25℃) |
| Colour Index | 764 |
| color | White to yellow-white |
| Odor | Odorless |
| PH Range | 8.0(colorless)-10(Red) |
| PH | 7.8~10.0 |
| Water Solubility | <0.1 g/100 mL |
| λmax | 552nm, 553nm, 374nm, 205nm, 229nm, 276nm |
| Merck | 14,7243 |
| BRN | 284423 |
| Henry's Law Constant | 1.1×1010 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability: | Stable. Incompatible with strong oxidizing agents, alkalies. |
| Major Application | Display device, sensors, semiconductors, fuel cells, photoreceptors, electronic packaging, authentication system for secure documents, inks, correction fluid, paints, detection of defects in films, floor coatings, textiles, corrosion testing, explosive, concrete, toys, detecting lipase activity of crop seeds, soaps, method for prevention of drugmisuse, cosmetics, diapers, detecting viable cells, carbohydrates, antimalarial, treating amyloid-associated diseases |
| InChI | 1S/C20H14O4/c21-15-9-5-13(6-10-15)20(14-7-11-16(22)12-8-14)18-4-2-1-3-17(18)19(23)24-20/h1-12,21-22H |
| InChIKey | KJFMBFZCATUALV-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1)C2(OC(=O)c3ccccc23)c4ccc(O)cc4 |
| LogP | 2.410 |
| CAS DataBase Reference | 77-09-8(CAS DataBase Reference) |
| IARC | 2B (Vol. 76) 2000 |
| NIST Chemistry Reference | Phenolphthalein(77-09-8) |
| EPA Substance Registry System | 3,3-Bis(4-hydroxyphenyl)phthalide (77-09-8) |
Description and Uses
Phenolphthalein can be used as an inhibitor and pH indicator. It also induces centrosome amplification and tubulin depolymerization in vitro.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H315-H341-H350-H361f |
| Precautionary statements | P202-P264-P280-P302+P352-P308+P313-P332+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,T,F,Xi |
| Risk Statements | 40-22-10-36/38-23/25-11-36/37/38-68-62-45-39/23/24/25-23/24/25 |
| Safety Statements | 45-36/37-33-24-16-7-36-26-53 |
| WGK Germany | 3 |
| RTECS | SM8380000 |
| TSCA | TSCA listed |
| HS Code | 29322910 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 1B Muta. 2 Repr. 2 Skin Irrit. 2 |
| Hazardous Substances Data | 77-09-8(Hazardous Substances Data) |
| REACH Registrations | Active |




