A5349512
Methyl orange , 96% , 547-58-0
Synonym(s):
4-[4-(Dimethylamino)phenylazo]benzenesulfonic acid sodium salt;4-Dimethylaminoazobenzene-4′-sulfonic acid sodium salt, Gold orange, Helianthine, Orange III;Acid Orange 52;Helianthin;Orange III
CAS NO.:547-58-0
Empirical Formula: C14H14N3NaO3S
Molecular Weight: 327.33
MDL number: MFCD00007502
EINECS: 208-925-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB28.80 | In Stock |
|
| 25G | RMB92.80 | In Stock |
|
| 100G | RMB286.40 | In Stock |
|
| 500g | RMB973.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 300 °C |
| Density | 0.987 g/mL at 25 °C |
| bulk density | 200-400kg/m3 |
| Flash point: | 37 °C |
| storage temp. | Store at +5°C to +30°C. |
| solubility | 5g/l |
| Colour Index | 13025 |
| form | Powder/Solid |
| pka | 3.4(at 25℃) |
| color | Yellow-Orange |
| Specific Gravity | 0.987 |
| Odor | Odorless |
| PH | 6.5 (5g/l, H2O, 20℃) |
| PH Range | 3.1(Red)-4.4(Orange) |
| Water Solubility | Soluble in ethanol. Partially soluble in hot water. Slightly soluble in cold water and pyrimidine. Insoluble in ether and alcohol. |
| λmax | 507nm, 522nm, 464nm |
| Merck | 14,6105 |
| BRN | 4732884 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Biological Applications | Detecting microorganisms; treating dermatological diseases,vaginal affections; dental materials; wound dressing materials |
| Major Application | Liquid crystals, thin films, sensors, sol-gel matrix, waveguides, host-guest chemistry, display device, corrosion inhibitor, glass coatings, paints, wound dressing materials, pharmaceuticals, dental materials, measuring nucleic acid |
| InChI | 1S/C14H15N3O3S.Na/c1-17(2)13-7-3-11(4-8-13)15-16-12-5-9-14(10-6-12)21(18,19)20;/h3-10H,1-2H3,(H,18,19,20);/q;+1/p-1/b16-15+; |
| InChIKey | STZCRXQWRGQSJD-GEEYTBSJSA-M |
| SMILES | [Na+].CN(C)c1ccc(cc1)\N=N\c2ccc(cc2)S([O-])(=O)=O |
| CAS DataBase Reference | 547-58-0 |
| EPA Substance Registry System | Methyl orange (547-58-0) |
Description and Uses
Methyl orange is a pH indicator frequently used in titrations, also used for histological microscopy.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 25-10 |
| Safety Statements | 45-24/25-16-36/37/39 |
| RIDADR | UN 3143 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DB6327000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29270000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Hazardous Substances Data | 547-58-0(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: 60 mg/kg |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |



