A6683112
Phenolphthalein , PhEur.,BP,98-101% , 77-09-8
Synonym(s):
3,3-Bis(4-hydroxyphenyl)-1(3H)-isobenzofuranone
CAS NO.:77-09-8
Empirical Formula: C20H14O4
Molecular Weight: 318.32
MDL number: MFCD00005913
EINECS: 201-004-7
| Pack Size | Price | Stock | Quantity |
| 100G | RMB56.00 | In Stock |
|
| 500G | RMB140.80 | In Stock |
|
| 2.5kg | RMB568.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 261-263 °C (lit.) |
| Boiling point: | 417.49°C (rough estimate) |
| Density | 1.27 g/cm3 at 32 °C |
| bulk density | 350-450kg/m3 |
| vapor pressure | <0.00001 Pa ( 50 °C) |
| refractive index | 1.5400 (estimate) |
| Flash point: | 24 °C |
| storage temp. | no restrictions. |
| solubility | Soluble in alcohol. Slightly soluble in ether. Slightly soluble in dimethyl sulfoxide and insoluble in benzene or hexane. |
| form | Solid |
| pka | 9.4(at 25℃) |
| Colour Index | 764 |
| color | White to yellow-white |
| PH | 7.8~10.0 |
| Odor | Odorless |
| PH Range | 8.0(colorless)-10(Red) |
| Water Solubility | <0.1 g/100 mL |
| λmax | 552nm, 553nm, 374nm, 205nm, 229nm, 276nm |
| Merck | 14,7243 |
| BRN | 284423 |
| Stability: | Stable. Incompatible with strong oxidizing agents, alkalies. |
| Major Application | Display device, sensors, semiconductors, fuel cells, photoreceptors, electronic packaging, authentication system for secure documents, inks, correction fluid, paints, detection of defects in films, floor coatings, textiles, corrosion testing, explosive, concrete, toys, detecting lipase activity of crop seeds, soaps, method for prevention of drugmisuse, cosmetics, diapers, detecting viable cells, carbohydrates, antimalarial, treating amyloid-associated diseases |
| Cosmetics Ingredients Functions | NOT REPORTED |
| InChI | 1S/C20H14O4/c21-15-9-5-13(6-10-15)20(14-7-11-16(22)12-8-14)18-4-2-1-3-17(18)19(23)24-20/h1-12,21-22H |
| InChIKey | KJFMBFZCATUALV-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1)C2(OC(=O)c3ccccc23)c4ccc(O)cc4 |
| LogP | 2.410 |
| CAS DataBase Reference | 77-09-8(CAS DataBase Reference) |
| IARC | 2B (Vol. 76) 2000 |
| NIST Chemistry Reference | Phenolphthalein(77-09-8) |
| EPA Substance Registry System | 3,3-Bis(4-hydroxyphenyl)phthalide (77-09-8) |
Description and Uses
Phenolphthalein is one of those chemicals that is commonly used in the chemistry laboratory to tell if a solution is acidic or alkaline . These chemicals are called acid - base indicators and used as indicator for acidimetric titrations. Phenolphthalein exerts laxative effects by stimulating the intestinal mucosa and constricting smooth muscles. However, phenolphthalein is no longer used as a laxative due to the suspected carcinogenicity of this compound.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H315-H341-H350-H361f |
| Precautionary statements | P202-P264-P280-P302+P352-P308+P313-P332+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,T,F,Xi |
| Risk Statements | 40-22-10-36/38-23/25-11-36/37/38-68-62-45-39/23/24/25-23/24/25 |
| Safety Statements | 45-36/37-33-24-16-7-36-26-53 |
| WGK Germany | 3 |
| RTECS | SM8380000 |
| TSCA | TSCA listed |
| HS Code | 29322910 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 1B Muta. 2 Repr. 2 Skin Irrit. 2 |
| Hazardous Substances Data | 77-09-8(Hazardous Substances Data) |




