A4298220
Protoporphyrin IX dimethyl ester , ≥90%(HPLC) , 5522-66-7
Synonym(s):
Dimethyl 8,13-divinyl-3,7,12,17-tetramethyl-21H,23H-porphine-2,18-dipropionate;Ooporpyhrin dimethyl ester
CAS NO.:5522-66-7
Empirical Formula: C36H38N4O4
Molecular Weight: 590.71
MDL number: MFCD29047709
EINECS: 226-870-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB814.40 | In Stock |
|
| 500mg | RMB1351.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 225-228 °C(lit.) |
| Boiling point: | 1017.0±65.0 °C(Predicted) |
| Density | 1.220±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO: soluble |
| form | crystal |
| color | purple |
| BRN | 381574 |
| Stability: | Light Sensitive |
| InChIKey | WASRLAPXOHTNAX-MFBGAUBSSA-N |
| SMILES | C(C1=C(C2=CC3=NC(=CC4=C(C=C)C(C)=C(N4)C=C4C(C)=C(CCC(=O)OC)C(=N4)C=C1N2)C(C)=C3C=C)C)CC(=O)OC |c:7,t:3,18,32| |
| EPA Substance Registry System | 21H,23H-Porphine-2,18-dipropanoic acid, 7,12-diethenyl-3,8,13,17-tetramethyl-, dimethyl ester (5522-66-7) |
Description and Uses
Protoporphyrin IX Dimethyl Ester is a derivative of Protoporphyrin IX (P839138), which is an important precursor to biologically essential prosthetic groups such as heme, cytochrome c, and chlorophylls.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H303-H320 |
| Precautionary statements | P312-P264-P305+P351+P338-P337+P313 |
| WGK Germany | 3 |
| F | 8-10-23 |






