A4300012
Fmoc-Arg(Pbf)-OH , 98% , 154445-77-9
Synonym(s):
Nα-Fmoc-Nω-(2,2,4,6,7-pentamethyldihydrobenzofuran-5-sulfonyl)-L -arginine;Nα-Fmoc-Nω-Pbf-L -arginine;Fmoc-Arg(Pbf)-OH;N-α-Fmoc-N G-(2,2,4,6,7-pentamethyldihydrobenzofuran-5-sulfonyl)-L-arginine
CAS NO.：154445-77-9
Empirical Formula: C34H40N4O7S
Molecular Weight: 648.77
MDL number: MFCD00235804
EINECS: 604-954-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB204.80 | In Stock |
|
| 100G | RMB787.20 | In Stock |
|
| 500g | RMB3619.20 | In Stock |
|
| 1kg | RMB6692.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132°C |
| alpha | -5.5 º (c=1,DMF) |
| Density | 1.37±0.1 g/cm3(Predicted) |
| storage temp. | Store at -15°C to -25°C. |
| solubility | DMF (Sparingly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.83±0.21(Predicted) |
| color | White to Off-White |
| optical activity | [α]/D -5.5±1.0°, c = 1 in DMF |
| BRN | 8302671 |
| InChIKey | YUMOVWGGELTYES-LJAQVGFWSA-N |
| SMILES | C(O)(=O)[C@H](CCCNC=NNS(C1=C(C)C(C)=C2OC(C)(C)CC2=C1C)(=O)=O)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 154445-77-9(CAS DataBase Reference) |
Description and Uses
Fmoc-Arg(Pbf)-OH is a Fmoc-protected amino acid derivative that can be used to create arginine-containing peptides. The 2,2,4,6,7-pentamethyIdlhydrobenzofuran-5-sulfonyl group (Pbf) can be easily cleaved by trifluoroacetic acid (TFA).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H332-H335-H315-H312-H319-H302 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P280-P302+P352-P312-P322-P363-P501-P264-P280-P305+P351+P338-P337+P313P-P264-P270-P301+P312-P330-P501-P261-P271-P304+P340-P312 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 1 |
| HS Code | 2935 90 90 |
| HazardClass | IRRITANT |
