Fmoc-Asn(Trt)-OH , 97% , 132388-59-1
Synonym(s):
Nα-(9-Fluorenylmethoxycarbonyl)-Nγ-trityl-L -asparagine;Nα-Fmoc-Nγ-trityl-L -asparagine;FMOC-Asn(Trt)-OH;N-α-Fmoc-N-β-trityl-L-asparagine
| Pack Size | Price | Stock | Quantity |
| 1g | RMB35.20 | In Stock |
|
| 5G | RMB36.80 | In Stock |
|
| 25G | RMB128.00 | In Stock |
|
| 100G | RMB454.40 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 201-204 °C(lit.) |
| alpha | -16 º (c=1, MeOH) |
| Boiling point: | 858.1±65.0 °C(Predicted) |
| Density | 1.271±0.06 g/cm3(Predicted) |
| refractive index | -19 ° (C=1, DMF) |
| storage temp. | 2-8°C |
| solubility | <0.00005g/l |
| pka | 3.79±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]20/D 15.0±1°, c = 1% in methanol |
| Water Solubility | <0.00005g/L |
| BRN | 4343823 |
| Major Application | peptide synthesis |
| InChIKey | KJYAFJQCGPUXJY-UUWRZZSWSA-N |
| SMILES | C(O)(=O)[C@H](CC(N)=O)N(C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)C(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS DataBase Reference | 132388-59-1(CAS DataBase Reference) |
Description and Uses
Fmoc-Asn(Trt)-OH prevents the possibility of the amide side chain from undergoing dehydration side reactions during activation, especially with carbodiimide reagents. Fmoc-Asn(Trt)-OH dissolves readily in all standard peptide synthesis reagents, while Fmoc-Asn-OH is only somewhat soluble in NMP or DMF. The trityl group is removed with TFA. This reaction is usually complete within 1 hour at room temperature, but is slower when the Asn(Trt) residue in at the N-terminal of the peptide. In these cases, the deprotection reaction should be extended to 2 hours.
Fmoc-Asn(Trt)-OH, is an amino acid derivative used in chemical synthesis and peptide chemistry.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H411 |
| Precautionary statements | P273-P391-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 53 |
| Safety Statements | 24/25-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 2 |
| F | 3-10 |
| HS Code | 2924 29 70 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 2 |
| Toxicity | LD50 orally in Rabbit: > 2000 mg/kg |







