A4300912
Fmoc-L-aspartic acid β-benzyl ester , 99% , 86060-84-6
Synonym(s):
Fmoc-L -aspartic acid 4-benzyl ester;Fmoc-Asp(OBzl)-OH;N-α-Fmoc-L-aspartic acid β-benzyl ester
| Pack Size | Price | Stock | Quantity |
| 1g | RMB43.20 | In Stock |
|
| 5G | RMB136.00 | In Stock |
|
| 25G | RMB472.80 | In Stock |
|
| 100g | RMB1362.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120-130 °C |
| alpha | -20 º (c=1% in DMF) |
| Boiling point: | 687.2±55.0 °C(Predicted) |
| Density | 1.310±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in methanol. |
| form | powder to crystal |
| pka | 3.54±0.23(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D 20.0±2°, c = 1% in DMF |
| BRN | 4609615 |
| Major Application | peptide synthesis |
| InChIKey | OQGAELAJEGGNKG-QHCPKHFHSA-N |
| SMILES | OC(=O)[C@H](CC(=O)OCc1ccccc1)NC(=O)OCC2c3ccccc3-c4ccccc24 |
| CAS DataBase Reference | 86060-84-6(CAS DataBase Reference) |
Description and Uses
Used as pharmaceutical intermediates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |






