A4305320
Tris(2,4-pentanedionato)indium(III) , >99.0% , 14405-45-9
Synonym(s):
2,4-Pentanedione indium(III) derivative;In(acac)3;Indium(III) 2,4-pentanedionate
CAS NO.:14405-45-9
Empirical Formula: C15H21InO6
Molecular Weight: 412.14
MDL number: MFCD00013494
EINECS: 238-378-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB47.20 | In Stock |
|
| 5G | RMB127.20 | In Stock |
|
| 25g | RMB559.20 | In Stock |
|
| 100g | RMB1999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 187-189 °C(lit.) |
| Boiling point: | 260-280°C |
| Density | 1,41 g/cm3 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Powder |
| Specific Gravity | 1.41 |
| color | off-white |
| Water Solubility | Soluble in benzene. Insoluble in water. |
| Hydrolytic Sensitivity | 5: forms reversible hydrate |
| Exposure limits | ACGIH: TWA 0.1 mg/m3 NIOSH: TWA 0.1 mg/m3 |
| InChI | 1S/3C5H8O2.In/c3*1-4(6)3-5(2)7;/h3*3,6H,1-2H3;/q;;;+3/p-3/b3*4-3-; |
| InChIKey | SKWCWFYBFZIXHE-LNTINUHCSA-K |
| SMILES | CC(=O)\C=C(\C)O[In](O\C(C)=C/C(C)=O)O\C(C)=C/C(C)=O |
| EPA Substance Registry System | Indium, tris(2,4-pentanedionato-.kappa.O,.kappa.O')-, (OC-6-11)- (14405-45-9) |
Description and Uses
Used in catalysts.Indium(III) 2,4-pentanedionate is used as a precursor for the preparation of indium(III)oxide. It acts as a catalyst in the synthesis of oxindole derivatives. It finds application in gas sensors. Further, it is used in the synthesis of indium tin oxide nanocrystals. In addition to this, it is involved in the preparation of thin-film solar cells by atomic layer chemical vapor deposition with hydrogen sulfide.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335-H351 |
| Precautionary statements | P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338-P308+P313 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-40 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | NL2025000 |
| TSCA | TSCA listed |
| HS Code | 29171900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






