A4305512
Fmoc-Thr-OH , 98% , 73731-37-0
Synonym(s):
Fmoc-L -threonine monohydrate
CAS NO.:73731-37-0
Empirical Formula: C19H19NO5
Molecular Weight: 341.36
MDL number: MFCD00077072
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB20.00 | In Stock |
|
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB79.20 | In Stock |
|
| 100g | RMB254.40 | In Stock |
|
| 500g | RMB1247.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115°C (dec.) |
| alpha | -16 º (c=1%, DMF) |
| Boiling point: | 596.5±50.0 °C(Predicted) |
| Density | 1.327±0.06 g/cm3(Predicted) |
| refractive index | -15.5 ° (C=1, DMF) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.49±0.10(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D 16±1°, c = 1% in DMF |
| BRN | 4300093 |
| Major Application | peptide synthesis |
| InChI | 1S/C19H19NO5.H2O/c1-11(21)17(18(22)23)20-19(24)25-10-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16;/h2-9,11,16-17,21H,10H2,1H3,(H,20,24)(H,22,23);1H2/t11-,17+;/m1./s1 |
| InChIKey | CGNQPFAECJFQNV-NRNQBQMASA-N |
| SMILES | O.C[C@@H](O)[C@H](NC(=O)OCC1c2ccccc2-c3ccccc13)C(O)=O |
| CAS DataBase Reference | 73731-37-0(CAS DataBase Reference) |
Description and Uses
N-Fmoc-L-threonine is an N-Fmoc-protected form of L-Threonine (T405500). L-Threonine is an essential amino acid that is commonly used as a feed and food additive. L-Threonine is produced in mass quantities by mutant Escherichia coli strains for research and food nutrition purposes. L-Threonine can be naturally found in fish and poultry, and is incorporated in some important proteins in the human body (such as hemoglobin and insulin).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-26 |
| WGK Germany | 3 |
| HS Code | 29242990 |
| Storage Class | 13 - Non Combustible Solids |







