A4305920
Thymolphthalein indicator , 90%(V/V) Ethanol contains 0.05%(W/V) , 125-20-2
Synonym(s):
5′,5′′-Diisopropyl-2′,2′′-dimethylphenolphthalein;Thymolphthalein
CAS NO.:125-20-2
Empirical Formula: C28H30O4
Molecular Weight: 430.54
MDL number: MFCD00005909
EINECS: 204-729-7
| Pack Size | Price | Stock | Quantity |
| 100ml | RMB143.20 | In Stock |
|
| 500ml | RMB396.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 251-253 °C(lit.) |
| Boiling point: | 504.79°C (rough estimate) |
| Density | 0.92 g/mL at 25 °C |
| bulk density | 400kg/m3 |
| vapor pressure | 0.002Pa at 90℃ |
| refractive index | 1.6400 (estimate) |
| Flash point: | 74 °F |
| storage temp. | no restrictions. |
| solubility | ethanol: clarity passes test |
| form | Low Melting Mass |
| pka | 9.70, 10.0(at 25℃) |
| color | White to slightly yellow |
| Specific Gravity | 0.92 |
| PH | 8.6~10.5 |
| PH Range | 9.3(colourless)-10.5(blue) |
| Odor | Mild characteristic odor |
| explosive limit | 3.30-19% |
| Water Solubility | insoluble |
| λmax | 592nm, 396nm, 598nm |
| Merck | 14,9401 |
| BRN | 359413 |
| Major Application | Display device, semiconductors, recording materials, photoconductors, sol-gel matrix, tin electroplating process, counterfeit-proof paper, authentication system forsecure documents, inks, pencil leads, correction fluid, paints, petroleum marker, tennis ball, adhesives, floor coatings, textiles, detergents, insecticide, lotion, cleaning pads, food storage, determine bacterial growth, Streptococci in saliva, dental impressionmaterials |
| InChI | 1S/C28H30O4/c1-15(2)20-13-23(17(5)11-25(20)29)28(22-10-8-7-9-19(22)27(31)32-28)24-14-21(16(3)4)26(30)12-18(24)6/h7-16,29-30H,1-6H3 |
| InChIKey | GRBHJPCWQRVGND-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(c(C)cc1O)C2(OC(=O)c3ccccc23)c4cc(C(C)C)c(O)cc4C |
| LogP | 3.682 at 25℃ |
| CAS DataBase Reference | 125-20-2(CAS DataBase Reference) |
| EPA Substance Registry System | Thymolphthalein (125-20-2) |
Description and Uses
Thymolphthalein is a pH sensitive dye that has multiple uses such as testing hydration and/or saliva testing.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H313-H333-H371 |
| Precautionary statements | P210-P260-P280a-P303+P361+P353-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | F,Xn |
| Risk Statements | 11-40-10 |
| Safety Statements | 7-16-36/37-24/25-22 |
| RIDADR | UN 1170 3/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29322980 |
| Storage Class | 11 - Combustible Solids |





