A4734331
Thymolblue-Phenolphthalein indicator , Indicator , 76-61-9
Synonym(s):
Thymol blue;Thymolsulfonphthalein
CAS NO.:76-61-9
Empirical Formula: C27H30O5S
Molecular Weight: 466.59
MDL number: MFCD00005869
EINECS: 200-973-3
| Pack Size | Price | Stock | Quantity |
| 100ml | RMB71.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 221-224 °C (dec.) (lit.) |
| Boiling point: | 539.4°C (rough estimate) |
| Density | 1.1413 (rough estimate) |
| bulk density | 350kg/m3 |
| refractive index | 1.5300 (estimate) |
| Flash point: | 36 °C |
| storage temp. | room temp |
| solubility | 0.11g/l |
| form | Solid |
| pka | Pka1:1.65(at 25℃)(PH=1.2 to 2.8) Pka2:8.9(at 25℃)(PH=8.0 to 9.6) |
| color | Dark green to dark brown |
| PH Range | 1.2(red)-2.8(yellow) 8(yellow)-9.6(blue) |
| Odor | Characteristic odour |
| PH | 1.2-2.8 8.0-9.6 |
| Water Solubility | Soluble in alcohol and dilute alkali solutions. Insoluble in water. |
| ε(extinction coefficient) | ≥12000 at 298-302nm in 0.1 M NaOH at 0.01g/L |
| λmax | 594nm, 376nm, 544nm, 430nm |
| Merck | 14,9400 |
| BRN | 368036 |
| Stability: | Stable. Combustible. Dust may form an explosive mixture with air. Incompatible with strong oxidizing agents. |
| Major Application | Display device, semiconductors, sensors, fuel cells, antimisting coating for glass, toys, corrosion inhibitor, multi-level alert system, correction fluid, textiles, falsification-proof security paper, packaging system, measurement of hydrogen ion concentrationin swimming pool water, humidity-indicating agent, diapers, cosmetics, biostatic materials, determine bacteria growth, psychoactive drugs, antidepressant drugs, dental impression material |
| InChI | 1S/C27H30O5S/c1-15(2)19-13-22(17(5)11-24(19)28)27(21-9-7-8-10-26(21)33(30,31)32-27)23-14-20(16(3)4)25(29)12-18(23)6/h7-16,28-29H,1-6H3 |
| InChIKey | PRZSXZWFJHEZBJ-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(c(C)cc1O)C(=C2\C=C(C(C)C)C(=O)C=C2C)\c3ccccc3S(O)(=O)=O |
| CAS DataBase Reference | 76-61-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Thymolsulfonephthalein(76-61-9) |
| EPA Substance Registry System | Phenol, 4,4'-(1,1-dioxido-3H-2,1-benzoxathiol-3-ylidene)bis[5-methyl-2-(1-methylethyl)- (76-61-9) |
Description and Uses
As as acid-base indicator; pH: red 1.2 to yellow 2.8; also yellow 8.0 to blue 9.6.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H225-H301+H311+H331 |
| Precautionary statements | P280-P305+P351+P338 |
| Risk Statements | 10 |
| Safety Statements | 24/25 |
| RIDADR | UN 1170 3/PG 3 |
| WGK Germany | 3 |
| RTECS | XP2575000 |
| TSCA | TSCA listed |
| HS Code | 2934 99 90 |
| PackingGroup | II |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2 |




