A4307012
Fenthion , Analysis standard , 55-38-9
Synonym(s):
O,O′-Dimethyl O″-[3-methyl-4-(methylthio)phenyl] thiophosphate
CAS NO.:55-38-9
Empirical Formula: C10H15O3PS2
Molecular Weight: 278.33
MDL number: MFCD00055449
EINECS: 200-231-9
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 7.5°C |
| Boiling point: | 87°C (0.01 mmHg) |
| Density | 1.25 |
| vapor pressure | 7.4 x 10-4 Pa (20 °C) |
| refractive index | nD20 1.5698 |
| Flash point: | >100 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), DMSO (Sparingly) |
| form | liquid |
| Water Solubility | 0.0055 g/100 mL |
| Merck | 13,4030 |
| BRN | 1974129 |
| Exposure limits | OSHA PEL: TWA 0.2 mg/m3; ACGIH TLV: TWA 0.2 mg/m3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | agriculture cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C10H15O3PS2/c1-8-7-9(5-6-10(8)16-4)13-14(15,11-2)12-3/h5-7H,1-4H3 |
| InChIKey | PNVJTZOFSHSLTO-UHFFFAOYSA-N |
| SMILES | COP(=S)(OC)Oc1ccc(SC)c(C)c1 |
| CAS DataBase Reference | 55-38-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Fenthion(55-38-9) |
| EPA Substance Registry System | Fenthion (55-38-9) |
Description and Uses
Fenthion is a colorless oily liquid (technical grade, brown oily liquid with a mercaptan-like odor).
Fenthion is an organothiophosphate used as an insecticide. Fenthion is also a potent acaricide.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H311-H330-H341-H372-H410 |
| Precautionary statements | P202-P260-P273-P280-P302+P352+P312-P304+P340+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T;N,N,T,Xn,F |
| Risk Statements | 21/22-23-48/25-50/53-68-67-65-38-11 |
| Safety Statements | 36/37-45-60-61-62 |
| RIDADR | UN 2810/3017 |
| WGK Germany | 3 |
| RTECS | TF9625000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29309090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 3 Dermal Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Muta. 2 STOT RE 1 Oral |
| Hazardous Substances Data | 55-38-9(Hazardous Substances Data) |
| Toxicity | LD50 in male, female rats (mg/kg): 215, 245 orally (Gaines) |





