A4313512
Fmoc-Glu(OBzl)-OH , ≥98.0%(HPLC) , 123639-61-2
Synonym(s):
Fmoc-Glu(OBzl)-OH;N-α-Fmoc-L-glutamic acid γ-benzyl ester
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB301.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | Decomposes |
| Boiling point: | 698.2±55.0 °C(Predicted) |
| Density | 1.289±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.70±0.10(Predicted) |
| color | White to off-white |
| optical activity | [α]20/D +12.0±2.5°, c =1% in chloroform |
| Major Application | peptide synthesis |
| InChIKey | HJJURMMMGPQIQP-DEOSSOPVSA-N |
| SMILES | C(O)(=O)[C@H](CCC(OCC1=CC=CC=C1)=O)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 123639-61-2(CAS DataBase Reference) |
Description and Uses
Fmoc-glu(obzl)-oh, is an amino acid derivative used in chemical synthesis and peptide chemistry.







