A4313712
Fmoc-His(Trt)-OH , 98% , 109425-51-6
Synonym(s):
Nα-Fmoc-N(im)-trityl-L -histidine;Fmoc-His(Trt)-OH;N-α-Fmoc-N-im-trityl-L-histidine
CAS NO.:109425-51-6
Empirical Formula: C40H33N3O4
Molecular Weight: 619.71
MDL number: MFCD00043332
EINECS: 439-640-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB143.20 | In Stock |
|
| 100G | RMB503.20 | In Stock |
|
| 500g | RMB2500.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150-155 °C(lit.) |
| alpha | +86.0 °(D/25)(c=5%inCHCl3) |
| Boiling point: | 811.7±65.0 °C(Predicted) |
| Density | 1.24±0.1 g/cm3(Predicted) |
| refractive index | 97 ° (C=5, CHCl3) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.06±0.10(Predicted) |
| color | White to off-white |
| optical activity | [α]/D 87±5°, c = 1 in chloroform |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Moisture Sensitive |
| BRN | 5204720 |
| Major Application | peptide synthesis |
| InChIKey | XXMYDXUIZKNHDT-QNGWXLTQSA-N |
| SMILES | OC(=O)[C@H](Cc1cn(cn1)C(c2ccccc2)(c3ccccc3)c4ccccc4)NC(=O)OCC5c6ccccc6-c7ccccc57 |
| CAS DataBase Reference | 109425-51-6(CAS DataBase Reference) |
Description and Uses
Fmoc-His(Trt)-OH is used in the synthesis and application of Fmoc-His(3-Bum)-OH.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P362+P364 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-24/25 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 2933 29 90 |
| Storage Class | 11 - Combustible Solids |






