A4314012
Fmoc-D-Leu-OH , 98% , 114360-54-2
Synonym(s):
Fmoc-D -leucine;Fmoc-D-Leu-OH;N-α-Fmoc-D-leucine
CAS NO.:114360-54-2
Empirical Formula: C21H23NO4
Molecular Weight: 353.41
MDL number: MFCD00062957
EINECS: 252-662-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB34.40 | In Stock |
|
| 25G | RMB140.80 | In Stock |
|
| 100g | RMB512.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155°C |
| Boiling point: | 559.8±33.0 °C(Predicted) |
| Density | 1+-.0.06 g/cm3(Predicted) |
| refractive index | 25 ° (C=1, DMF) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | powder to crystal |
| pka | 3.91±0.21(Predicted) |
| color | White to Almost white |
| optical activity | Consistent with structure |
| Water Solubility | Insoluble in water. |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C21H23NO4/c1-13(2)11-19(20(23)24)22-21(25)26-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,13,18-19H,11-12H2,1-2H3,(H,22,25)(H,23,24)/t19-/m1/s1 |
| InChIKey | CBPJQFCAFFNICX-LJQANCHMSA-N |
| SMILES | C(O)(=O)[C@@H](CC(C)C)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 114360-54-2(CAS DataBase Reference) |
Description and Uses
A convergent synthesis of the proposed structure of (+)-pestalazine B has been achieved in 4 steps using the N-alkylation of an unprotected tryptophan diketopiperazine with a 3a-bromopyrrolidinoindoline where the condensation between L-tryptophan methyl ester and N-Fmoc-D-leucine in the presence of EDC as coupling agent afforded the corresponding L-Trp-D-Leu dipeptide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H413 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |







