A4314312
Fmoc-D-Pro-OH , 98% , 101555-62-8
Synonym(s):
Fmoc-D -proline;Fmoc-D-Pro-OH;N-α-Fmoc-D-proline
CAS NO.:101555-62-8
Empirical Formula: C20H19NO4
Molecular Weight: 337.37
MDL number: MFCD00077067
EINECS: 1806241-263-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB151.20 | In Stock |
|
| 100g | RMB479.20 | In Stock |
|
| 500g | RMB1727.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110-116°C |
| Boiling point: | 548.6±43.0 °C(Predicted) |
| Density | 1.328±0.06 g/cm3(Predicted) |
| refractive index | 32 ° (C=1, DMF) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | powder to crystal |
| pka | 3.95±0.20(Predicted) |
| color | White to Light yellow |
| optical activity | [α]/D +31.0±3.0°, c = 1 in DMF |
| BRN | 5856698 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C20H19NO4/c22-19(23)18-10-5-11-21(18)20(24)25-12-17-15-8-3-1-6-13(15)14-7-2-4-9-16(14)17/h1-4,6-9,17-18H,5,10-12H2,(H,22,23)/t18-/m1/s1 |
| InChIKey | ZPGDWQNBZYOZTI-GOSISDBHSA-N |
| SMILES | N1(C(OCC2C3=C(C=CC=C3)C3=C2C=CC=C3)=O)CCC[C@@H]1C(O)=O |
| CAS DataBase Reference | 101555-62-8(CAS DataBase Reference) |
Description and Uses
In organic synthesis, N-Fmoc-D-proline are often employed as important intermediates in various areas such as peptide synthesis, asymmetric synthesis, medicinal chemistry, and polymer chemistry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2933 99 80 |
| Storage Class | 11 - Combustible Solids |






