A4314412
Fmoc-D-Ser(tBu)-OH , 98% , 128107-47-1
Synonym(s):
Fmoc-O-tert-butyl-D -serine;Fmoc-D-Ser(tBu)-OH;N-α-Fmoc-O-t.-butyl-D-serine
CAS NO.：128107-47-1
Empirical Formula: C22H25NO5
Molecular Weight: 383.44
MDL number: MFCD00077071
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB114.40 | In Stock |
|
| 25G | RMB393.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 131℃ |
| Boiling point: | 578.6±50.0 °C(Predicted) |
| Density | 1.216±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.44±0.10(Predicted) |
| color | White to off-white |
| optical activity | Consistent with structure |
| BRN | 5309984 |
| InChI | InChI=1S/C22H25NO5/c1-22(2,3)28-13-19(20(24)25)23-21(26)27-12-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,18-19H,12-13H2,1-3H3,(H,23,26)(H,24,25)/t19-/m1/s1 |
| InChIKey | REITVGIIZHFVGU-LJQANCHMSA-N |
| SMILES | C(O)(=O)[C@@H](COC(C)(C)C)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 128107-47-1(CAS DataBase Reference) |
Description and Uses
Fmoc-D-Ser(tBu)-OH, is an amino acid derivative used in chemical synthesis and peptide chemistry.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 2924 29 70 |
