A4314512
Fmoc-Ser(Bzl)-OH , 98% , 83792-48-7
CAS NO.：83792-48-7
Empirical Formula: C25H23NO5
Molecular Weight: 417.45
MDL number: MFCD00065674
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB45.60 | In Stock |
|
| 5G | RMB136.80 | In Stock |
|
| 25G | RMB555.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 642.4±55.0 °C(Predicted) |
| Density | 1.279±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.41±0.10(Predicted) |
| color | Pale brown |
| optical activity | Consistent with structure |
| InChIKey | DYBDGLCDMLNEMJ-QHCPKHFHSA-N |
| SMILES | C(O)(=O)[C@H](COCC1=CC=CC=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 83792-48-7(CAS DataBase Reference) |
Description and Uses
Fmoc-O-benzyl-L-serine is used in preparation of Cyclic Peptide antibiotics.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
