A4314912
Fmoc-Tyr(Bzl)-OH , 98% , 71989-40-7
Synonym(s):
Fmoc-O-benzyl-L -tyrosine
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB78.40 | In Stock |
|
| 25G | RMB362.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 157-161 °C |
| Boiling point: | 719.7±60.0 °C(Predicted) |
| Density | 1.271±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 2.96±0.10(Predicted) |
| color | White to off-white |
| optical activity | [α]20/D 16.0±2.5°, c = 1% in DMF |
| BRN | 4341195 |
| Major Application | peptide synthesis |
| InChIKey | REHSJSKPWIOKIJ-LJAQVGFWSA-N |
| SMILES | OC(=O)[C@H](Cc1ccc(OCc2ccccc2)cc1)NC(=O)OCC3c4ccccc4-c5ccccc35 |
| CAS DataBase Reference | 71989-40-7(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29242990 |
| Storage Class | 13 - Non Combustible Solids |







